C10H16F3NO3S — CID 113326445
2-acetamido-4-(4,4,4-trifluorobutylsulfanyl)butanoic acid (PubChem CID 113326445) has the molecular formula C10H16F3NO3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-acetamido-4-(4,4,4-trifluorobutylsulfanyl)butanoic acid.
| Compound Name | 2-acetamido-4-(4,4,4-trifluorobutylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 113326445 |
| Molecular Formula | C10H16F3NO3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-acetamido-4-(4,4,4-trifluorobutylsulfanyl)butanoic acid |
| SMILES | CC(=O)NC(CCSCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H16F3NO3S/c1-7(15)14-8(9(16)17)3-6-18-5-2-4-10(11,12)13/h8H,2-6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | CJXVOSRTYVCKFR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|