C8H15NO2S2 — CID 88891450
(2R)-2-methyl-N-[(2S)-3-oxo-1-sulfanylbutan-2-yl]-3-sulfanylpropanamide (PubChem CID 88891450) has the molecular formula C8H15NO2S2 and a molecular weight of 221.35 g/mol. Its IUPAC name is (2R)-2-methyl-N-[(2S)-3-oxo-1-sulfanylbutan-2-yl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-methyl-N-[(2S)-3-oxo-1-sulfanylbutan-2-yl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 88891450 |
| Molecular Formula | C8H15NO2S2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2R)-2-methyl-N-[(2S)-3-oxo-1-sulfanylbutan-2-yl]-3-sulfanylpropanamide |
| SMILES | CC(=O)[C@@H](CS)NC(=O)[C@@H](C)CS |
| InChI | InChI=1S/C8H15NO2S2/c1-5(3-12)8(11)9-7(4-13)6(2)10/h5,7,12-13H,3-4H2,1-2H3,(H,9,11)/t5-,7+/m0/s1 |
| InChIKey | RYJCCJVERVAQFB-CAHLUQPWSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|