C11H19NO3S — CID 59270329
(4S)-4-methyl-3-oxo-N-[(2R)-3-oxo-1-sulfanylbutan-2-yl]hexanamide (PubChem CID 59270329) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is (4S)-4-methyl-3-oxo-N-[(2R)-3-oxo-1-sulfanylbutan-2-yl]hexanamide.
| Compound Name | (4S)-4-methyl-3-oxo-N-[(2R)-3-oxo-1-sulfanylbutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 59270329 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (4S)-4-methyl-3-oxo-N-[(2R)-3-oxo-1-sulfanylbutan-2-yl]hexanamide |
| SMILES | CC[C@H](C)C(=O)CC(=O)N[C@@H](CS)C(C)=O |
| InChI | InChI=1S/C11H19NO3S/c1-4-7(2)10(14)5-11(15)12-9(6-16)8(3)13/h7,9,16H,4-6H2,1-3H3,(H,12,15)/t7-,9-/m0/s1 |
| InChIKey | MVBCBUDQEGYYBV-CBAPKCEASA-N |
| XLogP | 1.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|