C24H45N3O8S — CID 167643583
4-methyl-N-[2-[2-[2-[2-[3-oxo-3-[(3-oxo-1-sulfanylbutan-2-yl)amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-(propanoylamino)pentanamide (PubChem CID 167643583) has the molecular formula C24H45N3O8S and a molecular weight of 535.70 g/mol. Its IUPAC name is 4-methyl-N-[2-[2-[2-[2-[3-oxo-3-[(3-oxo-1-sulfanylbutan-2-yl)amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-(propanoylamino)pentanamide.
| Compound Name | 4-methyl-N-[2-[2-[2-[2-[3-oxo-3-[(3-oxo-1-sulfanylbutan-2-yl)amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-(propanoylamino)pentanamide |
|---|---|
| PubChem CID | 167643583 |
| Molecular Formula | C24H45N3O8S |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 4-methyl-N-[2-[2-[2-[2-[3-oxo-3-[(3-oxo-1-sulfanylbutan-2-yl)amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-(propanoylamino)pentanamide |
| SMILES | CCC(=O)NC(CC(C)C)C(=O)NCCOCCOCCOCCOCCC(=O)NC(CS)C(C)=O |
| InChI | InChI=1S/C24H45N3O8S/c1-5-22(29)26-20(16-18(2)3)24(31)25-7-9-33-11-13-35-15-14-34-12-10-32-8-6-23(30)27-21(17-36)19(4)28/h18,20-21,36H,5-17H2,1-4H3,(H,25,31)(H,26,29)(H,27,30) |
| InChIKey | PNCXSWHBQNWNPE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|