C18H34N4O8S — CID 121419492
(2S)-2-[[2-[2-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-3-sulfanylpropanamide (PubChem CID 121419492) has the molecular formula C18H34N4O8S and a molecular weight of 466.56 g/mol. Its IUPAC name is (2S)-2-[[2-[2-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-3-sulfanylpropanamide.
| Compound Name | (2S)-2-[[2-[2-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 121419492 |
| Molecular Formula | C18H34N4O8S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (2S)-2-[[2-[2-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-3-sulfanylpropanamide |
| SMILES | CCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)N[C@H](CS)C(N)=O |
| InChI | InChI=1S/C18H34N4O8S/c1-2-15(23)20-3-5-27-7-9-29-11-16(24)21-4-6-28-8-10-30-12-17(25)22-14(13-31)18(19)26/h14,31H,2-13H2,1H3,(H2,19,26)(H,20,23)(H,21,24)(H,22,25)/t14-/m1/s1 |
| InChIKey | AWWNOJSIMPCJOE-CQSZACIVSA-N |
| XLogP | -2.40 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|