C12H27NO3S — CID 145330835
ethane;ethyl (2R)-2-(propanoylamino)-3-sulfanylpropanoate (PubChem CID 145330835) has the molecular formula C12H27NO3S and a molecular weight of 265.42 g/mol. Its IUPAC name is ethane;ethyl (2R)-2-(propanoylamino)-3-sulfanylpropanoate.
| Compound Name | ethane;ethyl (2R)-2-(propanoylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 145330835 |
| Molecular Formula | C12H27NO3S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | ethane;ethyl (2R)-2-(propanoylamino)-3-sulfanylpropanoate |
| SMILES | CC.CC.CCOC(=O)[C@H](CS)NC(=O)CC |
| InChI | InChI=1S/C8H15NO3S.2C2H6/c1-3-7(10)9-6(5-13)8(11)12-4-2;2*1-2/h6,13H,3-5H2,1-2H3,(H,9,10);2*1-2H3/t6-;;/m0../s1 |
| InChIKey | SOKWGZXOICOXHV-ILKKLZGPSA-N |
| XLogP | 2.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|