C11H16ClN3O3S — CID 19520618
ethyl (2R)-2-[[2-(4-chloro-5-methylpyrazol-1-yl)acetyl]amino]-3-sulfanylpropanoate (PubChem CID 19520618) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-(4-chloro-5-methylpyrazol-1-yl)acetyl]amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[[2-(4-chloro-5-methylpyrazol-1-yl)acetyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19520618 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | ethyl (2R)-2-[[2-(4-chloro-5-methylpyrazol-1-yl)acetyl]amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)Cn1ncc(Cl)c1C |
| InChI | InChI=1S/C11H16ClN3O3S/c1-3-18-11(17)9(6-19)14-10(16)5-15-7(2)8(12)4-13-15/h4,9,19H,3,5-6H2,1-2H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | DZGKFVCMEVDQNL-VIFPVBQESA-N |
| XLogP | 0.82 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|