C11H17N3O3S — CID 19473969
ethyl (2R)-2-[(1,5-dimethylpyrazole-4-carbonyl)amino]-3-sulfanylpropanoate (PubChem CID 19473969) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl (2R)-2-[(1,5-dimethylpyrazole-4-carbonyl)amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[(1,5-dimethylpyrazole-4-carbonyl)amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19473969 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | ethyl (2R)-2-[(1,5-dimethylpyrazole-4-carbonyl)amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1cnn(C)c1C |
| InChI | InChI=1S/C11H17N3O3S/c1-4-17-11(16)9(6-18)13-10(15)8-5-12-14(3)7(8)2/h5,9,18H,4,6H2,1-3H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | JHTOIVGHQHPGFI-VIFPVBQESA-N |
| XLogP | 0.32 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|