C24H28N2O6S2 — CID 58451974
ethyl 2-[[4-[4-[(1-ethoxy-1-oxo-3-sulfanylpropan-2-yl)carbamoyl]phenyl]benzoyl]amino]-3-sulfanylpropanoate (PubChem CID 58451974) has the molecular formula C24H28N2O6S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is ethyl 2-[[4-[4-[(1-ethoxy-1-oxo-3-sulfanylpropan-2-yl)carbamoyl]phenyl]benzoyl]amino]-3-sulfanylpropanoate.
| Compound Name | ethyl 2-[[4-[4-[(1-ethoxy-1-oxo-3-sulfanylpropan-2-yl)carbamoyl]phenyl]benzoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 58451974 |
| Molecular Formula | C24H28N2O6S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | ethyl 2-[[4-[4-[(1-ethoxy-1-oxo-3-sulfanylpropan-2-yl)carbamoyl]phenyl]benzoyl]amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)C(CS)NC(=O)c1ccc(-c2ccc(C(=O)NC(CS)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O6S2/c1-3-31-23(29)19(13-33)25-21(27)17-9-5-15(6-10-17)16-7-11-18(12-8-16)22(28)26-20(14-34)24(30)32-4-2/h5-12,19-20,33-34H,3-4,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | YOJFUHGEBQTITL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|