C26H27NO3 — CID 175573876
ethyl 2-[(4-methylbenzoyl)amino]-4,4-diphenylbutanoate (PubChem CID 175573876) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is ethyl 2-[(4-methylbenzoyl)amino]-4,4-diphenylbutanoate.
| Compound Name | ethyl 2-[(4-methylbenzoyl)amino]-4,4-diphenylbutanoate |
|---|---|
| PubChem CID | 175573876 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethyl 2-[(4-methylbenzoyl)amino]-4,4-diphenylbutanoate |
| SMILES | CCOC(=O)C(CC(c1ccccc1)c1ccccc1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27NO3/c1-3-30-26(29)24(27-25(28)22-16-14-19(2)15-17-22)18-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,23-24H,3,18H2,1-2H3,(H,27,28) |
| InChIKey | BYHCBWRWMUPESV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |