C23H22N2O3 — CID 119035446
ethyl 2-[(4-phenylbenzoyl)amino]-3-pyridin-2-ylpropanoate (PubChem CID 119035446) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 2-[(4-phenylbenzoyl)amino]-3-pyridin-2-ylpropanoate.
| Compound Name | ethyl 2-[(4-phenylbenzoyl)amino]-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 119035446 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 2-[(4-phenylbenzoyl)amino]-3-pyridin-2-ylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccn1)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-2-28-23(27)21(16-20-10-6-7-15-24-20)25-22(26)19-13-11-18(12-14-19)17-8-4-3-5-9-17/h3-15,21H,2,16H2,1H3,(H,25,26) |
| InChIKey | XWONAVNJTWVMEV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |