2-(ethylamino)-3-pyridin-2-ylpropanoic acid

C10H14N2O2 — CID 83698578

IUPAC2-(ethylamino)-3-pyridin-2-ylpropanoic acid
SMILESCCNC(Cc1ccccn1)C(=O)O
InChIInChI=1S/C10H14N2O2/c1-2-11-9(10(13)14)7-8-5-3-4-6-12-8/h3-6,9,11H,2,7H2,1H3,(H,13,14)
InChIKeyQYBFLVFPQXIIJC-UHFFFAOYSA-N
MW194.23 g/mol
LogP0.69
Rot. Bonds5

About 2-(ethylamino)-3-pyridin-2-ylpropanoic acid

2-(ethylamino)-3-pyridin-2-ylpropanoic acid (PubChem CID 83698578) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(ethylamino)-3-pyridin-2-ylpropanoic acid.

Molecular Properties

Compound Name2-(ethylamino)-3-pyridin-2-ylpropanoic acid
PubChem CID83698578
Molecular FormulaC10H14N2O2
Molecular Weight194.23 g/mol
Exact Mass194.11
IUPAC Name2-(ethylamino)-3-pyridin-2-ylpropanoic acid
SMILESCCNC(Cc1ccccn1)C(=O)O
InChIInChI=1S/C10H14N2O2/c1-2-11-9(10(13)14)7-8-5-3-4-6-12-8/h3-6,9,11H,2,7H2,1H3,(H,13,14)
InChIKeyQYBFLVFPQXIIJC-UHFFFAOYSA-N
XLogP0.69
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(ethylamino)-3-pyridin-2-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(propanoylamino)-3-pyridin-2-ylpropanoic acid
CID 141086627
(2S)-2-(carboxyamino)-3-pyridin-2-ylpropanoic acid
CID 90150229
fermium;2-(oxomethylamino)-3-pyridin-2-ylpropanoic acid
CID 171093339
2-(cyclopentanecarbonylamino)-3-pyridin-2-ylpropanoic acid
CID 166247442
(1S)-N-ethyl-1-phenyl-2-pyridin-2-ylethanamine
CID 129365604
2-hydroxy-3-pyridin-2-ylpropanoic acid chloride
CID 5351816
2-[[(2R)-3-carboxy-1-pyridin-2-ylbut-3-en-2-yl]amino]-4-methylpentanoic acid
CID 142163725
ethyl 2-[(4-phenylbenzoyl)amino]-3-pyridin-2-ylpropanoate
CID 119035446
2-(2-pyridin-2-ylethylcarbamoylamino)pentanoic acid
CID 61183979
(2S)-2-amino-3-pyridin-2-ylpropanoic acid;hydrochloride
CID 46705394
ethane;3-methyl-4-pyridin-2-ylbutan-2-one
CID 177154285
N-ethyl-4-methylidene-1-pyridin-2-ylhexan-2-amine
CID 66044585

Frequently Asked Questions

What is the IUPAC name of 2-(ethylamino)-3-pyridin-2-ylpropanoic acid?
The IUPAC name of 2-(ethylamino)-3-pyridin-2-ylpropanoic acid (CID 83698578) is 2-(ethylamino)-3-pyridin-2-ylpropanoic acid.
What is the SMILES notation for 2-(ethylamino)-3-pyridin-2-ylpropanoic acid?
The canonical SMILES for 2-(ethylamino)-3-pyridin-2-ylpropanoic acid is CCNC(Cc1ccccn1)C(=O)O.
What is the InChIKey of 2-(ethylamino)-3-pyridin-2-ylpropanoic acid?
The InChIKey is QYBFLVFPQXIIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-2-11-9(10(13)14)7-8-5-3-4-6-12-8/h3-6,9,11H,2,7H2,1H3,(H,13,14).
What are the key properties of 2-(ethylamino)-3-pyridin-2-ylpropanoic acid?
2-(ethylamino)-3-pyridin-2-ylpropanoic acid has a molecular weight of 194.23 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-3-pyridin-2-ylpropanoic acid is sourced from PubChem (CID 83698578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).