C16H22N2O4 — CID 142163725
2-[[(2R)-3-carboxy-1-pyridin-2-ylbut-3-en-2-yl]amino]-4-methylpentanoic acid (PubChem CID 142163725) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[[(2R)-3-carboxy-1-pyridin-2-ylbut-3-en-2-yl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(2R)-3-carboxy-1-pyridin-2-ylbut-3-en-2-yl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 142163725 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[[(2R)-3-carboxy-1-pyridin-2-ylbut-3-en-2-yl]amino]-4-methylpentanoic acid |
| SMILES | C=C(C(=O)O)[C@@H](Cc1ccccn1)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H22N2O4/c1-10(2)8-14(16(21)22)18-13(11(3)15(19)20)9-12-6-4-5-7-17-12/h4-7,10,13-14,18H,3,8-9H2,1-2H3,(H,19,20)(H,21,22)/t13-,14?/m1/s1 |
| InChIKey | SGHMLDUWSAVAQB-KWCCSABGSA-N |
| XLogP | 1.72 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|