About 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum
2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum (PubChem CID 87206612) has the molecular formula C11H15NO4PtS
and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum.
Molecular Properties
| Compound Name | 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum |
| PubChem CID | 87206612 |
| Molecular Formula | C11H15NO4PtS |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum |
| SMILES | CSC(C)Cc1ccccn1.O=C(O)C(=O)O.[Pt] |
| InChI | InChI=1S/C9H13NS.C2H2O4.Pt/c1-8(11-2)7-9-5-3-4-6-10-9;3-1(4)2(5)6;/h3-6,8H,7H2,1-2H3;(H,3,4)(H,5,6); |
| InChIKey | CLFMOFITGCLIGB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum?
The IUPAC name of 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum (CID 87206612) is 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum.
What is the SMILES notation for 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum?
The canonical SMILES for 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum is CSC(C)Cc1ccccn1.O=C(O)C(=O)O.[Pt].
What is the InChIKey of 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum?
The InChIKey is CLFMOFITGCLIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.C2H2O4.Pt/c1-8(11-2)7-9-5-3-4-6-10-9;3-1(4)2(5)6;/h3-6,8H,7H2,1-2H3;(H,3,4)(H,5,6);.
What are the key properties of 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum?
2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum has a molecular weight of 452.39 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfanylpropyl)pyridine;oxalic acid;platinum is sourced from PubChem (CID 87206612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).