C11H17NO2 — CID 103456469
4-methyl-1-pyridin-2-ylpentane-2,3-diol (PubChem CID 103456469) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-methyl-1-pyridin-2-ylpentane-2,3-diol.
| Compound Name | 4-methyl-1-pyridin-2-ylpentane-2,3-diol |
|---|---|
| PubChem CID | 103456469 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-methyl-1-pyridin-2-ylpentane-2,3-diol |
| SMILES | CC(C)C(O)C(O)Cc1ccccn1 |
| InChI | InChI=1S/C11H17NO2/c1-8(2)11(14)10(13)7-9-5-3-4-6-12-9/h3-6,8,10-11,13-14H,7H2,1-2H3 |
| InChIKey | NSDOHORQHQVNCS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |