C10H13F2NO — CID 145217845
(3R)-2,2-difluoro-3-methyl-4-pyridin-2-ylbutan-1-ol (PubChem CID 145217845) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is (3R)-2,2-difluoro-3-methyl-4-pyridin-2-ylbutan-1-ol.
| Compound Name | (3R)-2,2-difluoro-3-methyl-4-pyridin-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 145217845 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (3R)-2,2-difluoro-3-methyl-4-pyridin-2-ylbutan-1-ol |
| SMILES | C[C@H](Cc1ccccn1)C(F)(F)CO |
| InChI | InChI=1S/C10H13F2NO/c1-8(10(11,12)7-14)6-9-4-2-3-5-13-9/h2-5,8,14H,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | DMONJRUCDFGNLV-MRVPVSSYSA-N |
| XLogP | 1.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |