C12H21N3 — CID 105315374
(3,4-dimethyl-1-pyridin-2-ylpentan-2-yl)hydrazine (PubChem CID 105315374) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (3,4-dimethyl-1-pyridin-2-ylpentan-2-yl)hydrazine.
| Compound Name | (3,4-dimethyl-1-pyridin-2-ylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105315374 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (3,4-dimethyl-1-pyridin-2-ylpentan-2-yl)hydrazine |
| SMILES | CC(C)C(C)C(Cc1ccccn1)NN |
| InChI | InChI=1S/C12H21N3/c1-9(2)10(3)12(15-13)8-11-6-4-5-7-14-11/h4-7,9-10,12,15H,8,13H2,1-3H3 |
| InChIKey | JXUMHSPWGJYFFN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|