C8H11F2N3 — CID 105264970
(1,1-difluoro-3-pyridin-2-ylpropan-2-yl)hydrazine (PubChem CID 105264970) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is (1,1-difluoro-3-pyridin-2-ylpropan-2-yl)hydrazine.
| Compound Name | (1,1-difluoro-3-pyridin-2-ylpropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105264970 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | (1,1-difluoro-3-pyridin-2-ylpropan-2-yl)hydrazine |
| SMILES | NNC(Cc1ccccn1)C(F)F |
| InChI | InChI=1S/C8H11F2N3/c9-8(10)7(13-11)5-6-3-1-2-4-12-6/h1-4,7-8,13H,5,11H2 |
| InChIKey | CUWSNAVMGQNBMN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|