C14H21N3 — CID 105315370
[1-(7-bicyclo[4.1.0]heptanyl)-2-pyridin-2-ylethyl]hydrazine (PubChem CID 105315370) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is [1-(7-bicyclo[4.1.0]heptanyl)-2-pyridin-2-ylethyl]hydrazine.
| Compound Name | [1-(7-bicyclo[4.1.0]heptanyl)-2-pyridin-2-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105315370 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | [1-(7-bicyclo[4.1.0]heptanyl)-2-pyridin-2-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccccn1)C1C2CCCCC21 |
| InChI | InChI=1S/C14H21N3/c15-17-13(9-10-5-3-4-8-16-10)14-11-6-1-2-7-12(11)14/h3-5,8,11-14,17H,1-2,6-7,9,15H2 |
| InChIKey | CAXGAWWSHQQSEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|