C11H17N3O2S — CID 105258767
[1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylethyl]hydrazine (PubChem CID 105258767) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylethyl]hydrazine.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105258767 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccccn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17N3O2S/c12-14-11(7-10-3-1-2-5-13-10)9-4-6-17(15,16)8-9/h1-3,5,9,11,14H,4,6-8,12H2 |
| InChIKey | UFPUHIQWAVQNES-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|