C10H15BrN2O2S2 — CID 105258979
[2-(3-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine (PubChem CID 105258979) has the molecular formula C10H15BrN2O2S2 and a molecular weight of 339.28 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258979 |
| Molecular Formula | C10H15BrN2O2S2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1sccc1Br)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15BrN2O2S2/c11-8-1-3-16-10(8)5-9(13-12)7-2-4-17(14,15)6-7/h1,3,7,9,13H,2,4-6,12H2 |
| InChIKey | TYJZGKOKNMHBAV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|