C10H15BrN2OS2 — CID 105249733
[2-(3-bromothiophen-2-yl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine (PubChem CID 105249733) has the molecular formula C10H15BrN2OS2 and a molecular weight of 323.28 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249733 |
| Molecular Formula | C10H15BrN2OS2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1sccc1Br)C1CSCCO1 |
| InChI | InChI=1S/C10H15BrN2OS2/c11-7-1-3-16-10(7)5-8(13-12)9-6-15-4-2-14-9/h1,3,8-9,13H,2,4-6,12H2 |
| InChIKey | ZUQSPOKMDWSSOQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|