C11H16BrNS2 — CID 105139532
2-(3-bromothiophen-2-yl)-N-methyl-1-(thiolan-3-yl)ethanamine (PubChem CID 105139532) has the molecular formula C11H16BrNS2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-N-methyl-1-(thiolan-3-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(thiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 105139532 |
| Molecular Formula | C11H16BrNS2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(thiolan-3-yl)ethanamine |
| SMILES | CNC(Cc1sccc1Br)C1CCSC1 |
| InChI | InChI=1S/C11H16BrNS2/c1-13-10(8-2-4-14-7-8)6-11-9(12)3-5-15-11/h3,5,8,10,13H,2,4,6-7H2,1H3 |
| InChIKey | HIBPHWPIDZCQSB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |