C11H18BrN3S2 — CID 106446358
[2-(3-bromothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine (PubChem CID 106446358) has the molecular formula C11H18BrN3S2 and a molecular weight of 336.32 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106446358 |
| Molecular Formula | C11H18BrN3S2 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
| SMILES | CN1CCSCC1C(Cc1sccc1Br)NN |
| InChI | InChI=1S/C11H18BrN3S2/c1-15-3-5-16-7-10(15)9(14-13)6-11-8(12)2-4-17-11/h2,4,9-10,14H,3,5-7,13H2,1H3 |
| InChIKey | XPFOGEUZHKTACE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|