C13H19F2N3S — CID 106446251
[2-(2,5-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine (PubChem CID 106446251) has the molecular formula C13H19F2N3S and a molecular weight of 287.38 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine.
| Compound Name | [2-(2,5-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106446251 |
| Molecular Formula | C13H19F2N3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [2-(2,5-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
| SMILES | CN1CCSCC1C(Cc1cc(F)ccc1F)NN |
| InChI | InChI=1S/C13H19F2N3S/c1-18-4-5-19-8-13(18)12(17-16)7-9-6-10(14)2-3-11(9)15/h2-3,6,12-13,17H,4-5,7-8,16H2,1H3 |
| InChIKey | NEUHFEULNDJNKK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|