C14H20ClFN2S — CID 106444833
2-(2-chloro-5-fluorophenyl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine (PubChem CID 106444833) has the molecular formula C14H20ClFN2S and a molecular weight of 302.85 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine |
|---|---|
| PubChem CID | 106444833 |
| Molecular Formula | C14H20ClFN2S |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-N-methyl-1-(4-methylthiomorpholin-3-yl)ethanamine |
| SMILES | CNC(Cc1cc(F)ccc1Cl)C1CSCCN1C |
| InChI | InChI=1S/C14H20ClFN2S/c1-17-13(14-9-19-6-5-18(14)2)8-10-7-11(16)3-4-12(10)15/h3-4,7,13-14,17H,5-6,8-9H2,1-2H3 |
| InChIKey | GBRHZYUOTSFXAE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |