C15H22ClFN2S — CID 106445174
2-(3-chloro-4-fluorophenyl)-N-ethyl-1-(4-methylthiomorpholin-3-yl)ethanamine (PubChem CID 106445174) has the molecular formula C15H22ClFN2S and a molecular weight of 316.87 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-N-ethyl-1-(4-methylthiomorpholin-3-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-N-ethyl-1-(4-methylthiomorpholin-3-yl)ethanamine |
|---|---|
| PubChem CID | 106445174 |
| Molecular Formula | C15H22ClFN2S |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-N-ethyl-1-(4-methylthiomorpholin-3-yl)ethanamine |
| SMILES | CCNC(Cc1ccc(F)c(Cl)c1)C1CSCCN1C |
| InChI | InChI=1S/C15H22ClFN2S/c1-3-18-14(15-10-20-7-6-19(15)2)9-11-4-5-13(17)12(16)8-11/h4-5,8,14-15,18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | LAKKDENTBZDVLS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |