C14H22FN3OS — CID 106446450
[2-(2-fluoro-3-methoxyphenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine (PubChem CID 106446450) has the molecular formula C14H22FN3OS and a molecular weight of 299.42 g/mol. Its IUPAC name is [2-(2-fluoro-3-methoxyphenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine.
| Compound Name | [2-(2-fluoro-3-methoxyphenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106446450 |
| Molecular Formula | C14H22FN3OS |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [2-(2-fluoro-3-methoxyphenyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
| SMILES | COc1cccc(CC(NN)C2CSCCN2C)c1F |
| InChI | InChI=1S/C14H22FN3OS/c1-18-6-7-20-9-12(18)11(17-16)8-10-4-3-5-13(19-2)14(10)15/h3-5,11-12,17H,6-9,16H2,1-2H3 |
| InChIKey | FNYGJYDPDXJKSN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|