C16H25FN2OS — CID 106445454
N-[(2-fluoro-3-methoxyphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine (PubChem CID 106445454) has the molecular formula C16H25FN2OS and a molecular weight of 312.45 g/mol. Its IUPAC name is N-[(2-fluoro-3-methoxyphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-fluoro-3-methoxyphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106445454 |
| Molecular Formula | C16H25FN2OS |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[(2-fluoro-3-methoxyphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(OC)c1F)C1CSCCN1C |
| InChI | InChI=1S/C16H25FN2OS/c1-4-8-18-16(13-11-21-10-9-19(13)2)12-6-5-7-14(20-3)15(12)17/h5-7,13,16,18H,4,8-11H2,1-3H3 |
| InChIKey | GAOIYXIQHZGZKK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |