C16H25FN2S — CID 106445479
N-[(3-fluoro-5-methylphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine (PubChem CID 106445479) has the molecular formula C16H25FN2S and a molecular weight of 296.45 g/mol. Its IUPAC name is N-[(3-fluoro-5-methylphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-fluoro-5-methylphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106445479 |
| Molecular Formula | C16H25FN2S |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[(3-fluoro-5-methylphenyl)-(4-methylthiomorpholin-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(C)cc(F)c1)C1CSCCN1C |
| InChI | InChI=1S/C16H25FN2S/c1-4-5-18-16(15-11-20-7-6-19(15)3)13-8-12(2)9-14(17)10-13/h8-10,15-16,18H,4-7,11H2,1-3H3 |
| InChIKey | UGEMXRZWJHLAKR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |