C12H15F2NOS — CID 103595528
(3,5-difluorophenyl)-(4-methylthiomorpholin-3-yl)methanol (PubChem CID 103595528) has the molecular formula C12H15F2NOS and a molecular weight of 259.32 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(4-methylthiomorpholin-3-yl)methanol.
| Compound Name | (3,5-difluorophenyl)-(4-methylthiomorpholin-3-yl)methanol |
|---|---|
| PubChem CID | 103595528 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (3,5-difluorophenyl)-(4-methylthiomorpholin-3-yl)methanol |
| SMILES | CN1CCSCC1C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NOS/c1-15-2-3-17-7-11(15)12(16)8-4-9(13)6-10(14)5-8/h4-6,11-12,16H,2-3,7H2,1H3 |
| InChIKey | GMJDYVIFZLNURF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |