C11H19N3OS — CID 103595649
(2-ethylpyrazol-3-yl)-(4-methylthiomorpholin-3-yl)methanol (PubChem CID 103595649) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl)-(4-methylthiomorpholin-3-yl)methanol.
| Compound Name | (2-ethylpyrazol-3-yl)-(4-methylthiomorpholin-3-yl)methanol |
|---|---|
| PubChem CID | 103595649 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (2-ethylpyrazol-3-yl)-(4-methylthiomorpholin-3-yl)methanol |
| SMILES | CCn1nccc1C(O)C1CSCCN1C |
| InChI | InChI=1S/C11H19N3OS/c1-3-14-9(4-5-12-14)11(15)10-8-16-7-6-13(10)2/h4-5,10-11,15H,3,6-8H2,1-2H3 |
| InChIKey | YQGBNHHGBWGEDK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |