C11H20N4S — CID 106444780
N-methyl-1-(2-methylpyrazol-3-yl)-1-(4-methylthiomorpholin-3-yl)methanamine (PubChem CID 106444780) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is N-methyl-1-(2-methylpyrazol-3-yl)-1-(4-methylthiomorpholin-3-yl)methanamine.
| Compound Name | N-methyl-1-(2-methylpyrazol-3-yl)-1-(4-methylthiomorpholin-3-yl)methanamine |
|---|---|
| PubChem CID | 106444780 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-methyl-1-(2-methylpyrazol-3-yl)-1-(4-methylthiomorpholin-3-yl)methanamine |
| SMILES | CNC(c1ccnn1C)C1CSCCN1C |
| InChI | InChI=1S/C11H20N4S/c1-12-11(9-4-5-13-15(9)3)10-8-16-7-6-14(10)2/h4-5,10-12H,6-8H2,1-3H3 |
| InChIKey | IOKUEFOLGWYBEI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |