C11H19ClN4S — CID 106444901
1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)methanamine (PubChem CID 106444901) has the molecular formula C11H19ClN4S and a molecular weight of 274.82 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)methanamine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)methanamine |
|---|---|
| PubChem CID | 106444901 |
| Molecular Formula | C11H19ClN4S |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(4-methylthiomorpholin-3-yl)methanamine |
| SMILES | CNC(c1c(Cl)cnn1C)C1CSCCN1C |
| InChI | InChI=1S/C11H19ClN4S/c1-13-10(9-7-17-5-4-15(9)2)11-8(12)6-14-16(11)3/h6,9-10,13H,4-5,7H2,1-3H3 |
| InChIKey | IBDOBJWIAQGOPO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |