C12H18N2OS — CID 103595725
1-(4-methylthiomorpholin-3-yl)-2-pyridin-3-ylethanol (PubChem CID 103595725) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-(4-methylthiomorpholin-3-yl)-2-pyridin-3-ylethanol.
| Compound Name | 1-(4-methylthiomorpholin-3-yl)-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 103595725 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(4-methylthiomorpholin-3-yl)-2-pyridin-3-ylethanol |
| SMILES | CN1CCSCC1C(O)Cc1cccnc1 |
| InChI | InChI=1S/C12H18N2OS/c1-14-5-6-16-9-11(14)12(15)7-10-3-2-4-13-8-10/h2-4,8,11-12,15H,5-7,9H2,1H3 |
| InChIKey | GOGWFBOYFOFXFD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |