C12H19N3S — CID 106444518
(4-methyl-3-pyridinyl)-(4-methylthiomorpholin-3-yl)methanamine (PubChem CID 106444518) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is (4-methyl-3-pyridinyl)-(4-methylthiomorpholin-3-yl)methanamine.
| Compound Name | (4-methyl-3-pyridinyl)-(4-methylthiomorpholin-3-yl)methanamine |
|---|---|
| PubChem CID | 106444518 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (4-methyl-3-pyridinyl)-(4-methylthiomorpholin-3-yl)methanamine |
| SMILES | Cc1ccncc1C(N)C1CSCCN1C |
| InChI | InChI=1S/C12H19N3S/c1-9-3-4-14-7-10(9)12(13)11-8-16-6-5-15(11)2/h3-4,7,11-12H,5-6,8,13H2,1-2H3 |
| InChIKey | ZQSIXBRZXJBSND-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |