C10H15ClN2S2 — CID 107360379
(3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanamine (PubChem CID 107360379) has the molecular formula C10H15ClN2S2 and a molecular weight of 262.83 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanamine.
| Compound Name | (3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanamine |
|---|---|
| PubChem CID | 107360379 |
| Molecular Formula | C10H15ClN2S2 |
| Molecular Weight | 262.83 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanamine |
| SMILES | CN1CCSCC1C(N)c1sccc1Cl |
| InChI | InChI=1S/C10H15ClN2S2/c1-13-3-5-14-6-8(13)9(12)10-7(11)2-4-15-10/h2,4,8-9H,3,5-6,12H2,1H3 |
| InChIKey | DPRBZZABMWCWMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |