C11H19N3S2 — CID 106446271
[(4-methylthiomorpholin-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 106446271) has the molecular formula C11H19N3S2 and a molecular weight of 257.43 g/mol. Its IUPAC name is [(4-methylthiomorpholin-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [(4-methylthiomorpholin-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106446271 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | [(4-methylthiomorpholin-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | Cc1sccc1C(NN)C1CSCCN1C |
| InChI | InChI=1S/C11H19N3S2/c1-8-9(3-5-16-8)11(13-12)10-7-15-6-4-14(10)2/h3,5,10-11,13H,4,6-7,12H2,1-2H3 |
| InChIKey | PCYBRWGJXWWPKF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|