C15H25N3OS — CID 106682865
[(2-methoxy-4,6-dimethylphenyl)-(4-methylthiomorpholin-3-yl)methyl]hydrazine (PubChem CID 106682865) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is [(2-methoxy-4,6-dimethylphenyl)-(4-methylthiomorpholin-3-yl)methyl]hydrazine.
| Compound Name | [(2-methoxy-4,6-dimethylphenyl)-(4-methylthiomorpholin-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106682865 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [(2-methoxy-4,6-dimethylphenyl)-(4-methylthiomorpholin-3-yl)methyl]hydrazine |
| SMILES | COc1cc(C)cc(C)c1C(NN)C1CSCCN1C |
| InChI | InChI=1S/C15H25N3OS/c1-10-7-11(2)14(13(8-10)19-4)15(17-16)12-9-20-6-5-18(12)3/h7-8,12,15,17H,5-6,9,16H2,1-4H3 |
| InChIKey | UHEINRXYCMUXCV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|