C11H19N5S — CID 106446429
3-[hydrazinyl-(4-methylthiomorpholin-3-yl)methyl]pyridin-4-amine (PubChem CID 106446429) has the molecular formula C11H19N5S and a molecular weight of 253.38 g/mol. Its IUPAC name is 3-[hydrazinyl-(4-methylthiomorpholin-3-yl)methyl]pyridin-4-amine.
| Compound Name | 3-[hydrazinyl-(4-methylthiomorpholin-3-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 106446429 |
| Molecular Formula | C11H19N5S |
| Molecular Weight | 253.38 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-[hydrazinyl-(4-methylthiomorpholin-3-yl)methyl]pyridin-4-amine |
| SMILES | CN1CCSCC1C(NN)c1cnccc1N |
| InChI | InChI=1S/C11H19N5S/c1-16-4-5-17-7-10(16)11(15-13)8-6-14-3-2-9(8)12/h2-3,6,10-11,15H,4-5,7,13H2,1H3,(H2,12,14) |
| InChIKey | CFRGILCYSFSUCU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|