C11H18N2S2 — CID 103595870
(4-methylthiomorpholin-3-yl)-(3-methylthiophen-2-yl)methanamine (PubChem CID 103595870) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is (4-methylthiomorpholin-3-yl)-(3-methylthiophen-2-yl)methanamine.
| Compound Name | (4-methylthiomorpholin-3-yl)-(3-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 103595870 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (4-methylthiomorpholin-3-yl)-(3-methylthiophen-2-yl)methanamine |
| SMILES | Cc1ccsc1C(N)C1CSCCN1C |
| InChI | InChI=1S/C11H18N2S2/c1-8-3-5-15-11(8)10(12)9-7-14-6-4-13(9)2/h3,5,9-10H,4,6-7,12H2,1-2H3 |
| InChIKey | KSOSOYHPTOPUBS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |