C11H17NO2S — CID 103595628
2-(furan-3-yl)-1-(4-methylthiomorpholin-3-yl)ethanol (PubChem CID 103595628) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-(4-methylthiomorpholin-3-yl)ethanol.
| Compound Name | 2-(furan-3-yl)-1-(4-methylthiomorpholin-3-yl)ethanol |
|---|---|
| PubChem CID | 103595628 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(furan-3-yl)-1-(4-methylthiomorpholin-3-yl)ethanol |
| SMILES | CN1CCSCC1C(O)Cc1ccoc1 |
| InChI | InChI=1S/C11H17NO2S/c1-12-3-5-15-8-10(12)11(13)6-9-2-4-14-7-9/h2,4,7,10-11,13H,3,5-6,8H2,1H3 |
| InChIKey | IGQQVZXLRVNNJW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |