C13H17BrFNOS — CID 103595830
2-(5-bromo-2-fluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanol (PubChem CID 103595830) has the molecular formula C13H17BrFNOS and a molecular weight of 334.25 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanol |
|---|---|
| PubChem CID | 103595830 |
| Molecular Formula | C13H17BrFNOS |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanol |
| SMILES | CN1CCSCC1C(O)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H17BrFNOS/c1-16-4-5-18-8-12(16)13(17)7-9-6-10(14)2-3-11(9)15/h2-3,6,12-13,17H,4-5,7-8H2,1H3 |
| InChIKey | DAAHHOISGJMWHU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |