C12H13BrFNOS — CID 103595395
(5-bromo-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanone (PubChem CID 103595395) has the molecular formula C12H13BrFNOS and a molecular weight of 318.21 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanone.
| Compound Name | (5-bromo-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanone |
|---|---|
| PubChem CID | 103595395 |
| Molecular Formula | C12H13BrFNOS |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanone |
| SMILES | CN1CCSCC1C(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H13BrFNOS/c1-15-4-5-17-7-11(15)12(16)9-6-8(13)2-3-10(9)14/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | OIJOGSHUIZTLCW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |