C10H16N2OS2 — CID 79972080
1,4-dithian-2-yl-(2-ethylpyrazol-3-yl)methanol (PubChem CID 79972080) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(2-ethylpyrazol-3-yl)methanol.
| Compound Name | 1,4-dithian-2-yl-(2-ethylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 79972080 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1,4-dithian-2-yl-(2-ethylpyrazol-3-yl)methanol |
| SMILES | CCn1nccc1C(O)C1CSCCS1 |
| InChI | InChI=1S/C10H16N2OS2/c1-2-12-8(3-4-11-12)10(13)9-7-14-5-6-15-9/h3-4,9-10,13H,2,5-7H2,1H3 |
| InChIKey | GXOGLYYZELCNDD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |