C9H15N3S2 — CID 79972695
1,4-dithian-2-yl-(2-methylpyrazol-3-yl)methanamine (PubChem CID 79972695) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(2-methylpyrazol-3-yl)methanamine.
| Compound Name | 1,4-dithian-2-yl-(2-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 79972695 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1,4-dithian-2-yl-(2-methylpyrazol-3-yl)methanamine |
| SMILES | Cn1nccc1C(N)C1CSCCS1 |
| InChI | InChI=1S/C9H15N3S2/c1-12-7(2-3-11-12)9(10)8-6-13-4-5-14-8/h2-3,8-9H,4-6,10H2,1H3 |
| InChIKey | FCUPCXFIEAFJJC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |