C9H15N3O — CID 65330620
(2-methylpyrazol-3-yl)-(oxolan-3-yl)methanamine (PubChem CID 65330620) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-(oxolan-3-yl)methanamine.
| Compound Name | (2-methylpyrazol-3-yl)-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 65330620 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (2-methylpyrazol-3-yl)-(oxolan-3-yl)methanamine |
| SMILES | Cn1nccc1C(N)C1CCOC1 |
| InChI | InChI=1S/C9H15N3O/c1-12-8(2-4-11-12)9(10)7-3-5-13-6-7/h2,4,7,9H,3,5-6,10H2,1H3 |
| InChIKey | LEBXKZPXXXKOAJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |