C10H16N2O2 — CID 63960737
(2-methylpyrazol-3-yl)-(oxan-4-yl)methanol (PubChem CID 63960737) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-(oxan-4-yl)methanol.
| Compound Name | (2-methylpyrazol-3-yl)-(oxan-4-yl)methanol |
|---|---|
| PubChem CID | 63960737 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2-methylpyrazol-3-yl)-(oxan-4-yl)methanol |
| SMILES | Cn1nccc1C(O)C1CCOCC1 |
| InChI | InChI=1S/C10H16N2O2/c1-12-9(2-5-11-12)10(13)8-3-6-14-7-4-8/h2,5,8,10,13H,3-4,6-7H2,1H3 |
| InChIKey | NVQOSKWBMWMTOC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |