C9H13N3O — CID 130510505
2,5-dihydro-1H-pyrrol-2-yl-(2-methylpyrazol-3-yl)methanol (PubChem CID 130510505) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrrol-2-yl-(2-methylpyrazol-3-yl)methanol.
| Compound Name | 2,5-dihydro-1H-pyrrol-2-yl-(2-methylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 130510505 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2,5-dihydro-1H-pyrrol-2-yl-(2-methylpyrazol-3-yl)methanol |
| SMILES | Cn1nccc1C(O)C1C=CCN1 |
| InChI | InChI=1S/C9H13N3O/c1-12-8(4-6-11-12)9(13)7-3-2-5-10-7/h2-4,6-7,9-10,13H,5H2,1H3 |
| InChIKey | SZSOHCIXJAICPD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|