C12H20N2O2 — CID 103451942
1-[hydroxy-(2-methylpyrazol-3-yl)methyl]cycloheptan-1-ol (PubChem CID 103451942) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-[hydroxy-(2-methylpyrazol-3-yl)methyl]cycloheptan-1-ol.
| Compound Name | 1-[hydroxy-(2-methylpyrazol-3-yl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103451942 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-[hydroxy-(2-methylpyrazol-3-yl)methyl]cycloheptan-1-ol |
| SMILES | Cn1nccc1C(O)C1(O)CCCCCC1 |
| InChI | InChI=1S/C12H20N2O2/c1-14-10(6-9-13-14)11(15)12(16)7-4-2-3-5-8-12/h6,9,11,15-16H,2-5,7-8H2,1H3 |
| InChIKey | ZOIAPVAPWXXZTM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |